C12H11NO — CID 86694682
3-oxo-3-[(1R,2R)-2-phenylcyclopropyl]propanenitrile (PubChem CID 86694682) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-oxo-3-[(1R,2R)-2-phenylcyclopropyl]propanenitrile.
| Compound Name | 3-oxo-3-[(1R,2R)-2-phenylcyclopropyl]propanenitrile |
|---|---|
| PubChem CID | 86694682 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3-oxo-3-[(1R,2R)-2-phenylcyclopropyl]propanenitrile |
| SMILES | N#CCC(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H11NO/c13-7-6-12(14)11-8-10(11)9-4-2-1-3-5-9/h1-5,10-11H,6,8H2/t10-,11+/m0/s1 |
| InChIKey | LKMDBVHQUZFJPE-WDEREUQCSA-N |
| XLogP | 2.27 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |