C15H18O — CID 114974761
1-(2-phenylcyclopropyl)hex-5-en-1-one (PubChem CID 114974761) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(2-phenylcyclopropyl)hex-5-en-1-one.
| Compound Name | 1-(2-phenylcyclopropyl)hex-5-en-1-one |
|---|---|
| PubChem CID | 114974761 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(2-phenylcyclopropyl)hex-5-en-1-one |
| SMILES | C=CCCCC(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C15H18O/c1-2-3-5-10-15(16)14-11-13(14)12-8-6-4-7-9-12/h2,4,6-9,13-14H,1,3,5,10-11H2 |
| InChIKey | VDEYFHXNEHTTHL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|