C17H15FO — CID 159213870
2-(4-fluorophenyl)-1-[(1S,2S)-2-phenylcyclopropyl]ethanone (PubChem CID 159213870) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[(1S,2S)-2-phenylcyclopropyl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[(1S,2S)-2-phenylcyclopropyl]ethanone |
|---|---|
| PubChem CID | 159213870 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[(1S,2S)-2-phenylcyclopropyl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15FO/c18-14-8-6-12(7-9-14)10-17(19)16-11-15(16)13-4-2-1-3-5-13/h1-9,15-16H,10-11H2/t15-,16+/m1/s1 |
| InChIKey | KQVFFQUKOUSDFH-CVEARBPZSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |