C14H19O4P — CID 10708009
3-dimethoxyphosphoryl-1-[(1S,2S)-2-phenylcyclopropyl]propan-1-one (PubChem CID 10708009) has the molecular formula C14H19O4P and a molecular weight of 282.28 g/mol. Its IUPAC name is 3-dimethoxyphosphoryl-1-[(1S,2S)-2-phenylcyclopropyl]propan-1-one.
| Compound Name | 3-dimethoxyphosphoryl-1-[(1S,2S)-2-phenylcyclopropyl]propan-1-one |
|---|---|
| PubChem CID | 10708009 |
| Molecular Formula | C14H19O4P |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-dimethoxyphosphoryl-1-[(1S,2S)-2-phenylcyclopropyl]propan-1-one |
| SMILES | COP(=O)(CCC(=O)[C@H]1C[C@@H]1c1ccccc1)OC |
| InChI | InChI=1S/C14H19O4P/c1-17-19(16,18-2)9-8-14(15)13-10-12(13)11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | IIRAVBRSHQHYOA-OLZOCXBDSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|