C17H16N2O — CID 101455931
(3R,4R,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidine-4-carbonitrile (PubChem CID 101455931) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is (3R,4R,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidine-4-carbonitrile.
| Compound Name | (3R,4R,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 101455931 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (3R,4R,5S)-2-methyl-3,5-diphenyl-1,2-oxazolidine-4-carbonitrile |
| SMILES | CN1O[C@H](c2ccccc2)[C@@H](C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c1-19-16(13-8-4-2-5-9-13)15(12-18)17(20-19)14-10-6-3-7-11-14/h2-11,15-17H,1H3/t15-,16-,17+/m0/s1 |
| InChIKey | LCQHGPOZDJVOSX-YESZJQIVSA-N |
| XLogP | 3.49 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |