C12H16INO — CID 10686939
(3R,4S,5R)-5-(iodomethyl)-2,4-dimethyl-3-phenyl-1,2-oxazolidine (PubChem CID 10686939) has the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. Its IUPAC name is (3R,4S,5R)-5-(iodomethyl)-2,4-dimethyl-3-phenyl-1,2-oxazolidine.
| Compound Name | (3R,4S,5R)-5-(iodomethyl)-2,4-dimethyl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10686939 |
| Molecular Formula | C12H16INO |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (3R,4S,5R)-5-(iodomethyl)-2,4-dimethyl-3-phenyl-1,2-oxazolidine |
| SMILES | C[C@@H]1[C@H](CI)ON(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16INO/c1-9-11(8-13)15-14(2)12(9)10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3/t9-,11+,12-/m1/s1 |
| InChIKey | DCGDSZNXGKWRHZ-ADEWGFFLSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|