C19H24N2S2 — CID 123934151
2-ethyl-1,3-bis(methylsulfanyl)-4,5-diphenylimidazolidine (PubChem CID 123934151) has the molecular formula C19H24N2S2 and a molecular weight of 344.55 g/mol. Its IUPAC name is 2-ethyl-1,3-bis(methylsulfanyl)-4,5-diphenylimidazolidine.
| Compound Name | 2-ethyl-1,3-bis(methylsulfanyl)-4,5-diphenylimidazolidine |
|---|---|
| PubChem CID | 123934151 |
| Molecular Formula | C19H24N2S2 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-ethyl-1,3-bis(methylsulfanyl)-4,5-diphenylimidazolidine |
| SMILES | CCC1N(SC)C(c2ccccc2)C(c2ccccc2)N1SC |
| InChI | InChI=1S/C19H24N2S2/c1-4-17-20(22-2)18(15-11-7-5-8-12-15)19(21(17)23-3)16-13-9-6-10-14-16/h5-14,17-19H,4H2,1-3H3 |
| InChIKey | QWQUTDXAOQCFDB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|