C10H12S — CID 134927560
(2S,3R)-2-ethyl-3-phenylthiirane (PubChem CID 134927560) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is (2S,3R)-2-ethyl-3-phenylthiirane.
| Compound Name | (2S,3R)-2-ethyl-3-phenylthiirane |
|---|---|
| PubChem CID | 134927560 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2S,3R)-2-ethyl-3-phenylthiirane |
| SMILES | CC[C@@H]1S[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H12S/c1-2-9-10(11-9)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-,10+/m0/s1 |
| InChIKey | ZHEKIJLMKRZJFH-VHSXEESVSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|