C11H14O2S2 — CID 151184902
[5-(hydroxymethyl)-2-phenyl-1,3-dithiolan-4-yl]methanol (PubChem CID 151184902) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2-phenyl-1,3-dithiolan-4-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-2-phenyl-1,3-dithiolan-4-yl]methanol |
|---|---|
| PubChem CID | 151184902 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [5-(hydroxymethyl)-2-phenyl-1,3-dithiolan-4-yl]methanol |
| SMILES | OCC1SC(c2ccccc2)SC1CO |
| InChI | InChI=1S/C11H14O2S2/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2 |
| InChIKey | NFBRNGOPAVVOJR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |