C16H14OS2 — CID 141027854
[2-(4-phenylphenyl)-1,3-dithiol-4-yl]methanol (PubChem CID 141027854) has the molecular formula C16H14OS2 and a molecular weight of 286.42 g/mol. Its IUPAC name is [2-(4-phenylphenyl)-1,3-dithiol-4-yl]methanol.
| Compound Name | [2-(4-phenylphenyl)-1,3-dithiol-4-yl]methanol |
|---|---|
| PubChem CID | 141027854 |
| Molecular Formula | C16H14OS2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [2-(4-phenylphenyl)-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=CSC(c2ccc(-c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C16H14OS2/c17-10-15-11-18-16(19-15)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,11,16-17H,10H2 |
| InChIKey | LSOFZHBGWIDYEM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |