C11H16NO3+ — CID 135009649
(2S,3R,4R,5R)-2-(hydroxymethyl)-5-phenylpyrrolidin-1-ium-3,4-diol (PubChem CID 135009649) has the molecular formula C11H16NO3+ and a molecular weight of 210.25 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(hydroxymethyl)-5-phenylpyrrolidin-1-ium-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-(hydroxymethyl)-5-phenylpyrrolidin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 135009649 |
| Molecular Formula | C11H16NO3+ |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2S,3R,4R,5R)-2-(hydroxymethyl)-5-phenylpyrrolidin-1-ium-3,4-diol |
| SMILES | OC[C@@H]1[NH2+][C@H](c2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15NO3/c13-6-8-10(14)11(15)9(12-8)7-4-2-1-3-5-7/h1-5,8-15H,6H2/p+1/t8-,9+,10+,11+/m0/s1 |
| InChIKey | VXZYWQYETUQRMH-LNFKQOIKSA-O |
| XLogP | -1.61 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |