C21H28NO+ — CID 7310293
(2S,3S,4R,5R,6S)-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol (PubChem CID 7310293) has the molecular formula C21H28NO+ and a molecular weight of 310.46 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4R,5R,6S)-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7310293 |
| Molecular Formula | C21H28NO+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (2S,3S,4R,5R,6S)-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol |
| SMILES | CCC[C@H]1[C@H](O)[C@@H](C)[C@@H](c2ccccc2)[NH2+][C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-3-10-18-20(17-13-8-5-9-14-17)22-19(15(2)21(18)23)16-11-6-4-7-12-16/h4-9,11-15,18-23H,3,10H2,1-2H3/p+1/t15-,18+,19-,20+,21+/m0/s1 |
| InChIKey | GCUZTKRRUTYKPX-FZHKGVQDSA-O |
| XLogP | 3.46 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |