C19H22NO+ — CID 3672350
3,5-dimethyl-2,6-diphenylpiperidin-1-ium-4-one (PubChem CID 3672350) has the molecular formula C19H22NO+ and a molecular weight of 280.39 g/mol. Its IUPAC name is 3,5-dimethyl-2,6-diphenylpiperidin-1-ium-4-one.
| Compound Name | 3,5-dimethyl-2,6-diphenylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 3672350 |
| Molecular Formula | C19H22NO+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3,5-dimethyl-2,6-diphenylpiperidin-1-ium-4-one |
| SMILES | CC1C(=O)C(C)C(c2ccccc2)[NH2+]C1c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-13-17(15-9-5-3-6-10-15)20-18(14(2)19(13)21)16-11-7-4-8-12-16/h3-14,17-18,20H,1-2H3/p+1 |
| InChIKey | KRIROHZWSALYAG-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |