C25H25OPS — CID 12671063
(2R,3S,5R,6R)-3,5-dimethyl-1,2,6-triphenyl-1-sulfanylidene-1λ5-phosphinan-4-one (PubChem CID 12671063) has the molecular formula C25H25OPS and a molecular weight of 404.52 g/mol. Its IUPAC name is (2R,3S,5R,6R)-3,5-dimethyl-1,2,6-triphenyl-1-sulfanylidene-1λ5-phosphinan-4-one.
| Compound Name | (2R,3S,5R,6R)-3,5-dimethyl-1,2,6-triphenyl-1-sulfanylidene-1λ5-phosphinan-4-one |
|---|---|
| PubChem CID | 12671063 |
| Molecular Formula | C25H25OPS |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2R,3S,5R,6R)-3,5-dimethyl-1,2,6-triphenyl-1-sulfanylidene-1λ5-phosphinan-4-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@H](c2ccccc2)P(=S)(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25OPS/c1-18-23(26)19(2)25(21-14-8-4-9-15-21)27(28,22-16-10-5-11-17-22)24(18)20-12-6-3-7-13-20/h3-19,24-25H,1-2H3/t18-,19+,24-,25-,27?/m1/s1 |
| InChIKey | CZYBJWCUZFNIEA-UEGKIQBDSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|