C18H21N2O+ — CID 7124282
N-[(2S,3S,6S)-3-methyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7124282) has the molecular formula C18H21N2O+ and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[(2S,3S,6S)-3-methyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | N-[(2S,3S,6S)-3-methyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7124282 |
| Molecular Formula | C18H21N2O+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(2S,3S,6S)-3-methyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C(=NO)C[C@@H](c2ccccc2)[NH2+][C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-13-16(20-21)12-17(14-8-4-2-5-9-14)19-18(13)15-10-6-3-7-11-15/h2-11,13,17-19,21H,12H2,1H3/p+1/t13-,17+,18+/m1/s1 |
| InChIKey | MKDXFVQSWSAIDD-BVGQSLNGSA-O |
| XLogP | 2.90 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|