C19H23N2O+ — CID 7124271
N-[(2R,3S,6S)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7124271) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[(2R,3S,6S)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | N-[(2R,3S,6S)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7124271 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[(2R,3S,6S)-1,3-dimethyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C(=NO)C[C@@H](c2ccccc2)[NH+](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-14-17(20-22)13-18(15-9-5-3-6-10-15)21(2)19(14)16-11-7-4-8-12-16/h3-12,14,18-19,22H,13H2,1-2H3/p+1/t14-,18+,19-/m1/s1 |
| InChIKey | WRZFUOOSXMQGBT-MDASCCDHSA-O |
| XLogP | 2.85 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|