C15H23N2O+ — CID 7329332
(NE)-N-[(2S,5S)-2,5-dimethyl-1-(2-phenylethyl)piperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7329332) has the molecular formula C15H23N2O+ and a molecular weight of 247.36 g/mol. Its IUPAC name is (NE)-N-[(2S,5S)-2,5-dimethyl-1-(2-phenylethyl)piperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2S,5S)-2,5-dimethyl-1-(2-phenylethyl)piperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7329332 |
| Molecular Formula | C15H23N2O+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (NE)-N-[(2S,5S)-2,5-dimethyl-1-(2-phenylethyl)piperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | C[C@H]1C[NH+](CCc2ccccc2)[C@@H](C)C/C1=N\O |
| InChI | InChI=1S/C15H22N2O/c1-12-11-17(13(2)10-15(12)16-18)9-8-14-6-4-3-5-7-14/h3-7,12-13,18H,8-11H2,1-2H3/p+1/b16-15+/t12-,13-/m0/s1 |
| InChIKey | RSOJDXFITJOAFZ-SAFUZZNQSA-O |
| XLogP | 1.37 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|