C19H32N2+2 — CID 7047233
(3S)-3-methyl-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium (PubChem CID 7047233) has the molecular formula C19H32N2+2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (3S)-3-methyl-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium.
| Compound Name | (3S)-3-methyl-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 7047233 |
| Molecular Formula | C19H32N2+2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (3S)-3-methyl-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium |
| SMILES | C[C@H]1CCC[NH+](C2CC[NH+](CCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C19H30N2/c1-17-6-5-12-21(16-17)19-10-14-20(15-11-19)13-9-18-7-3-2-4-8-18/h2-4,7-8,17,19H,5-6,9-16H2,1H3/p+2/t17-/m0/s1 |
| InChIKey | GALMFCIMTCNSMV-KRWDZBQOSA-P |
| XLogP | 0.59 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |