C14H24N2+2 — CID 9160807
[(2R)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]-2-phenylethyl]azanium (PubChem CID 9160807) has the molecular formula C14H24N2+2 and a molecular weight of 220.36 g/mol. Its IUPAC name is [(2R)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]-2-phenylethyl]azanium.
| Compound Name | [(2R)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 9160807 |
| Molecular Formula | C14H24N2+2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | [(2R)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]-2-phenylethyl]azanium |
| SMILES | C[C@H]1CCC[NH+]([C@@H](C[NH3+])c2ccccc2)C1 |
| InChI | InChI=1S/C14H22N2/c1-12-6-5-9-16(11-12)14(10-15)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11,15H2,1H3/p+2/t12-,14-/m0/s1 |
| InChIKey | LHQTWACZUTUCKS-JSGCOSHPSA-P |
| XLogP | 0.28 |
| TPSA | 32.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |