C23H38N2+2 — CID 6980810
(3S)-3-methyl-1-[1-(4-phenylcyclohexyl)piperidin-1-ium-4-yl]piperidin-1-ium (PubChem CID 6980810) has the molecular formula C23H38N2+2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (3S)-3-methyl-1-[1-(4-phenylcyclohexyl)piperidin-1-ium-4-yl]piperidin-1-ium.
| Compound Name | (3S)-3-methyl-1-[1-(4-phenylcyclohexyl)piperidin-1-ium-4-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 6980810 |
| Molecular Formula | C23H38N2+2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (3S)-3-methyl-1-[1-(4-phenylcyclohexyl)piperidin-1-ium-4-yl]piperidin-1-ium |
| SMILES | C[C@H]1CCC[NH+](C2CC[NH+](C3CCC(c4ccccc4)CC3)CC2)C1 |
| InChI | InChI=1S/C23H36N2/c1-19-6-5-15-25(18-19)23-13-16-24(17-14-23)22-11-9-21(10-12-22)20-7-3-2-4-8-20/h2-4,7-8,19,21-23H,5-6,9-18H2,1H3/p+2/t19-,21?,22?/m0/s1 |
| InChIKey | RKMFYLNHYCBZIB-KPQWGBOZSA-P |
| XLogP | 2.07 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |