C20H34N2+2 — CID 7026473
1-[(2R)-butan-2-yl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium (PubChem CID 7026473) has the molecular formula C20H34N2+2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium.
| Compound Name | 1-[(2R)-butan-2-yl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7026473 |
| Molecular Formula | C20H34N2+2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-4-(4-phenylcyclohexyl)piperazine-1,4-diium |
| SMILES | CC[C@@H](C)[NH+]1CC[NH+](C2CCC(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H32N2/c1-3-17(2)21-13-15-22(16-14-21)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-8,17,19-20H,3,9-16H2,1-2H3/p+2/t17-,19?,20?/m1/s1 |
| InChIKey | KWDAXLMBWKAZOQ-QHGAOEGBSA-P |
| XLogP | 1.29 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |