C18H30N2O+2 — CID 7047298
(3R)-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium-3-ol (PubChem CID 7047298) has the molecular formula C18H30N2O+2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3R)-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium-3-ol.
| Compound Name | (3R)-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 7047298 |
| Molecular Formula | C18H30N2O+2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | (3R)-1-[1-(2-phenylethyl)piperidin-1-ium-4-yl]piperidin-1-ium-3-ol |
| SMILES | O[C@@H]1CCC[NH+](C2CC[NH+](CCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H28N2O/c21-18-7-4-11-20(15-18)17-9-13-19(14-10-17)12-8-16-5-2-1-3-6-16/h1-3,5-6,17-18,21H,4,7-15H2/p+2/t18-/m1/s1 |
| InChIKey | SZVSQICNJKOEAI-GOSISDBHSA-P |
| XLogP | -0.68 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |