C16H20NO+ — CID 6939510
(3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-ol (PubChem CID 6939510) has the molecular formula C16H20NO+ and a molecular weight of 242.34 g/mol. Its IUPAC name is (3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-ol.
| Compound Name | (3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 6939510 |
| Molecular Formula | C16H20NO+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-ol |
| SMILES | O[C@H]1CCC[NH+](Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C16H19NO/c18-15-8-4-10-17(12-15)11-14-7-3-6-13-5-1-2-9-16(13)14/h1-3,5-7,9,15,18H,4,8,10-12H2/p+1/t15-/m0/s1 |
| InChIKey | YEZFYEJRKPRXID-HNNXBMFYSA-O |
| XLogP | 1.38 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |