C16H22N4+2 — CID 8007600
[4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-ylidene]methanediamine (PubChem CID 8007600) has the molecular formula C16H22N4+2 and a molecular weight of 270.38 g/mol. Its IUPAC name is [4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-ylidene]methanediamine.
| Compound Name | [4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 8007600 |
| Molecular Formula | C16H22N4+2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [4-(naphthalen-1-ylmethyl)piperazine-1,4-diium-1-ylidene]methanediamine |
| SMILES | NC(N)=[N+]1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C16H20N4/c17-16(18)20-10-8-19(9-11-20)12-14-6-3-5-13-4-1-2-7-15(13)14/h1-7H,8-12H2,(H3,17,18)/p+2 |
| InChIKey | SIHPNJPVHRGBAY-UHFFFAOYSA-P |
| XLogP | -0.48 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|