C19H24N3S+ — CID 9097476
4-(naphthalen-1-ylmethyl)-N-prop-2-enylpiperazin-4-ium-1-carbothioamide (PubChem CID 9097476) has the molecular formula C19H24N3S+ and a molecular weight of 326.49 g/mol. Its IUPAC name is 4-(naphthalen-1-ylmethyl)-N-prop-2-enylpiperazin-4-ium-1-carbothioamide.
| Compound Name | 4-(naphthalen-1-ylmethyl)-N-prop-2-enylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9097476 |
| Molecular Formula | C19H24N3S+ |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-(naphthalen-1-ylmethyl)-N-prop-2-enylpiperazin-4-ium-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C19H23N3S/c1-2-10-20-19(23)22-13-11-21(12-14-22)15-17-8-5-7-16-6-3-4-9-18(16)17/h2-9H,1,10-15H2,(H,20,23)/p+1 |
| InChIKey | SGSKTTCQEZBCGV-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|