C15H20FN3S — CID 8726052
4-[(2-fluorophenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 8726052) has the molecular formula C15H20FN3S and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-[(2-fluorophenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8726052 |
| Molecular Formula | C15H20FN3S |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[(2-fluorophenyl)methyl]-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C15H20FN3S/c1-2-7-17-15(20)19-10-8-18(9-11-19)12-13-5-3-4-6-14(13)16/h2-6H,1,7-12H2,(H,17,20) |
| InChIKey | ISFUIYATBVAYTQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|