C13H22N2+2 — CID 7009132
1-(2-phenylethyl)-1,4-diazepane-1,4-diium (PubChem CID 7009132) has the molecular formula C13H22N2+2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(2-phenylethyl)-1,4-diazepane-1,4-diium.
| Compound Name | 1-(2-phenylethyl)-1,4-diazepane-1,4-diium |
|---|---|
| PubChem CID | 7009132 |
| Molecular Formula | C13H22N2+2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(2-phenylethyl)-1,4-diazepane-1,4-diium |
| SMILES | c1ccc(CC[NH+]2CCC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-2-5-13(6-3-1)7-11-15-10-4-8-14-9-12-15/h1-3,5-6,14H,4,7-12H2/p+2 |
| InChIKey | KWDPAPUJVTXSDX-UHFFFAOYSA-P |
| XLogP | -0.92 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |