C12H19BrN2+2 — CID 7170016
1-[(4-bromophenyl)methyl]-1,4-diazepane-1,4-diium (PubChem CID 7170016) has the molecular formula C12H19BrN2+2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,4-diazepane-1,4-diium.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,4-diazepane-1,4-diium |
|---|---|
| PubChem CID | 7170016 |
| Molecular Formula | C12H19BrN2+2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,4-diazepane-1,4-diium |
| SMILES | Brc1ccc(C[NH+]2CCC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C12H17BrN2/c13-12-4-2-11(3-5-12)10-15-8-1-6-14-7-9-15/h2-5,14H,1,6-10H2/p+2 |
| InChIKey | PUTBARDRYLXING-UHFFFAOYSA-P |
| XLogP | -0.20 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |