C16H21BrN2O+2 — CID 4741914
1-[(4-bromophenyl)methyl]-4-(furan-2-ylmethyl)piperazine-1,4-diium (PubChem CID 4741914) has the molecular formula C16H21BrN2O+2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-(furan-2-ylmethyl)piperazine-1,4-diium.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-(furan-2-ylmethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 4741914 |
| Molecular Formula | C16H21BrN2O+2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-(furan-2-ylmethyl)piperazine-1,4-diium |
| SMILES | Brc1ccc(C[NH+]2CC[NH+](Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C16H19BrN2O/c17-15-5-3-14(4-6-15)12-18-7-9-19(10-8-18)13-16-2-1-11-20-16/h1-6,11H,7-10,12-13H2/p+2 |
| InChIKey | WGIQPCUQNARILO-UHFFFAOYSA-P |
| XLogP | 0.53 |
| TPSA | 22.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |