C19H25BrN2O+2 — CID 7107356
(1S)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-bromophenyl)ethanol (PubChem CID 7107356) has the molecular formula C19H25BrN2O+2 and a molecular weight of 377.33 g/mol. Its IUPAC name is (1S)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-bromophenyl)ethanol.
| Compound Name | (1S)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-bromophenyl)ethanol |
|---|---|
| PubChem CID | 7107356 |
| Molecular Formula | C19H25BrN2O+2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (1S)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-bromophenyl)ethanol |
| SMILES | O[C@H](C[NH+]1CC[NH+](Cc2ccccc2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN2O/c20-18-8-6-17(7-9-18)19(23)15-22-12-10-21(11-13-22)14-16-4-2-1-3-5-16/h1-9,19,23H,10-15H2/p+2/t19-/m1/s1 |
| InChIKey | GWEAYNAKNNEYOS-LJQANCHMSA-P |
| XLogP | 0.47 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |