C14H24N2O+2 — CID 6590867
(1R)-2-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-phenylethanol (PubChem CID 6590867) has the molecular formula C14H24N2O+2 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1R)-2-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-phenylethanol.
| Compound Name | (1R)-2-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 6590867 |
| Molecular Formula | C14H24N2O+2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (1R)-2-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-phenylethanol |
| SMILES | C[NH+]1CCC[NH+](C[C@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-15-8-5-9-16(11-10-15)12-14(17)13-6-3-2-4-7-13/h2-4,6-7,14,17H,5,8-12H2,1H3/p+2/t14-/m0/s1 |
| InChIKey | DFGYEERMFFUZDK-AWEZNQCLSA-P |
| XLogP | -1.48 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |