C13H20NO+ — CID 7354795
(1R)-1-phenyl-2-piperidin-1-ium-1-ylethanol (PubChem CID 7354795) has the molecular formula C13H20NO+ and a molecular weight of 206.31 g/mol. Its IUPAC name is (1R)-1-phenyl-2-piperidin-1-ium-1-ylethanol.
| Compound Name | (1R)-1-phenyl-2-piperidin-1-ium-1-ylethanol |
|---|---|
| PubChem CID | 7354795 |
| Molecular Formula | C13H20NO+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (1R)-1-phenyl-2-piperidin-1-ium-1-ylethanol |
| SMILES | O[C@@H](C[NH+]1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c15-13(12-7-3-1-4-8-12)11-14-9-5-2-6-10-14/h1,3-4,7-8,13,15H,2,5-6,9-11H2/p+1/t13-/m0/s1 |
| InChIKey | WMZSIEGEKUAGJB-ZDUSSCGKSA-O |
| XLogP | 0.79 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |