C21H25ClNO+ — CID 5037308
3-(azepan-1-ium-1-yl)-1-(4-chlorophenyl)-2-phenylpropan-1-one (PubChem CID 5037308) has the molecular formula C21H25ClNO+ and a molecular weight of 342.89 g/mol. Its IUPAC name is 3-(azepan-1-ium-1-yl)-1-(4-chlorophenyl)-2-phenylpropan-1-one.
| Compound Name | 3-(azepan-1-ium-1-yl)-1-(4-chlorophenyl)-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 5037308 |
| Molecular Formula | C21H25ClNO+ |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-(azepan-1-ium-1-yl)-1-(4-chlorophenyl)-2-phenylpropan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1)C(C[NH+]1CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H24ClNO/c22-19-12-10-18(11-13-19)21(24)20(17-8-4-3-5-9-17)16-23-14-6-1-2-7-15-23/h3-5,8-13,20H,1-2,6-7,14-16H2/p+1 |
| InChIKey | RUULYUYZHVPRFZ-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |