C20H23ClFNO3 — CID 44667894
1-(3-fluoro-4-methoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-one chloride (PubChem CID 44667894) has the molecular formula C20H23ClFNO3 and a molecular weight of 379.86 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-one chloride.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-one chloride |
|---|---|
| PubChem CID | 44667894 |
| Molecular Formula | C20H23ClFNO3 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-one chloride |
| SMILES | COc1ccc(C(=O)C(C[NH+]2CCOCC2)c2ccccc2)cc1F.[Cl-] |
| InChI | InChI=1S/C20H22FNO3.ClH/c1-24-19-8-7-16(13-18(19)21)20(23)17(15-5-3-2-4-6-15)14-22-9-11-25-12-10-22;/h2-8,13,17H,9-12,14H2,1H3;1H |
| InChIKey | OFYKNKGCHNPWTQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |