C23H19FO4 — CID 7542520
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 7542520) has the molecular formula C23H19FO4 and a molecular weight of 378.40 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 7542520 |
| Molecular Formula | C23H19FO4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | COc1ccc(C(=O)COC(=O)C(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C23H19FO4/c1-27-21-13-12-18(14-19(21)24)20(25)15-28-23(26)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,22H,15H2,1H3 |
| InChIKey | UERBBTDOEFHEOR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |