About [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 7547952) has the molecular formula C23H19FO5
and a molecular weight of 394.40 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate |
| PubChem CID | 7547952 |
| Molecular Formula | C23H19FO5 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(OCc3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C23H19FO5/c1-27-22-12-9-18(13-20(22)24)21(25)15-29-23(26)17-7-10-19(11-8-17)28-14-16-5-3-2-4-6-16/h2-13H,14-15H2,1H3 |
| InChIKey | WPKARSBBSSXOHY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate?
The IUPAC name of [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate (CID 7547952) is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate.
What is the SMILES notation for [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate?
The canonical SMILES for [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate is COc1ccc(C(=O)COC(=O)c2ccc(OCc3ccccc3)cc2)cc1F.
What is the InChIKey of [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate?
The InChIKey is WPKARSBBSSXOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FO5/c1-27-22-12-9-18(13-20(22)24)21(25)15-29-23(26)17-7-10-19(11-8-17)28-14-16-5-3-2-4-6-16/h2-13H,14-15H2,1H3.
What are the key properties of [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate?
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate has a molecular weight of 394.40 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 4-phenylmethoxybenzoate is sourced from PubChem (CID 7547952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).