C21H26ClN2O2+ — CID 7022437
benzyl N-[(1S)-1-(4-chlorophenyl)-2-pyrrolidin-1-ium-1-ylethyl]-N-methylcarbamate (PubChem CID 7022437) has the molecular formula C21H26ClN2O2+ and a molecular weight of 373.90 g/mol. Its IUPAC name is benzyl N-[(1S)-1-(4-chlorophenyl)-2-pyrrolidin-1-ium-1-ylethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(1S)-1-(4-chlorophenyl)-2-pyrrolidin-1-ium-1-ylethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 7022437 |
| Molecular Formula | C21H26ClN2O2+ |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | benzyl N-[(1S)-1-(4-chlorophenyl)-2-pyrrolidin-1-ium-1-ylethyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)[C@H](C[NH+]1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-23(21(25)26-16-17-7-3-2-4-8-17)20(15-24-13-5-6-14-24)18-9-11-19(22)12-10-18/h2-4,7-12,20H,5-6,13-16H2,1H3/p+1/t20-/m1/s1 |
| InChIKey | NKFRUBGRRCMOOP-HXUWFJFHSA-O |
| XLogP | 3.33 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |