C13H20N2O2+2 — CID 7129028
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazine-1,4-diium (PubChem CID 7129028) has the molecular formula C13H20N2O2+2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazine-1,4-diium.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7129028 |
| Molecular Formula | C13H20N2O2+2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazine-1,4-diium |
| SMILES | c1cc2c(cc1C[NH+]1CC[NH2+]CC1)OCCO2 |
| InChI | InChI=1S/C13H18N2O2/c1-2-12-13(17-8-7-16-12)9-11(1)10-15-5-3-14-4-6-15/h1-2,9,14H,3-8,10H2/p+2 |
| InChIKey | PQDMWCAXHTUPRD-UHFFFAOYSA-P |
| XLogP | -1.58 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |