C26H30N2O2+2 — CID 7445406
1-(1,3-benzodioxol-5-ylmethyl)-4-(2,2-diphenylethyl)piperazine-1,4-diium (PubChem CID 7445406) has the molecular formula C26H30N2O2+2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,2-diphenylethyl)piperazine-1,4-diium.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,2-diphenylethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 7445406 |
| Molecular Formula | C26H30N2O2+2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,2-diphenylethyl)piperazine-1,4-diium |
| SMILES | c1ccc(C(C[NH+]2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-3-7-22(8-4-1)24(23-9-5-2-6-10-23)19-28-15-13-27(14-16-28)18-21-11-12-25-26(17-21)30-20-29-25/h1-12,17,24H,13-16,18-20H2/p+2 |
| InChIKey | HXRWRNXFFRZWMV-UHFFFAOYSA-P |
| XLogP | 1.53 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |