C22H30N2O3S+2 — CID 7481987
(2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-3-phenylmethoxypropane-2-thiol (PubChem CID 7481987) has the molecular formula C22H30N2O3S+2 and a molecular weight of 402.56 g/mol. Its IUPAC name is (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-3-phenylmethoxypropane-2-thiol.
| Compound Name | (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-3-phenylmethoxypropane-2-thiol |
|---|---|
| PubChem CID | 7481987 |
| Molecular Formula | C22H30N2O3S+2 |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2R)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-3-phenylmethoxypropane-2-thiol |
| SMILES | S[C@@H](COCc1ccccc1)C[NH+]1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H28N2O3S/c28-20(16-25-15-18-4-2-1-3-5-18)14-24-10-8-23(9-11-24)13-19-6-7-21-22(12-19)27-17-26-21/h1-7,12,20,28H,8-11,13-17H2/p+2/t20-/m1/s1 |
| InChIKey | CTCIGFHMLGKYCR-HXUWFJFHSA-P |
| XLogP | 0.21 |
| TPSA | 36.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|