C19H32N2+2 — CID 4584207
1-cyclohexyl-4-(3-phenylpropyl)piperazine-1,4-diium (PubChem CID 4584207) has the molecular formula C19H32N2+2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-cyclohexyl-4-(3-phenylpropyl)piperazine-1,4-diium.
| Compound Name | 1-cyclohexyl-4-(3-phenylpropyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 4584207 |
| Molecular Formula | C19H32N2+2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-cyclohexyl-4-(3-phenylpropyl)piperazine-1,4-diium |
| SMILES | c1ccc(CCC[NH+]2CC[NH+](C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H30N2/c1-3-8-18(9-4-1)10-7-13-20-14-16-21(17-15-20)19-11-5-2-6-12-19/h1,3-4,8-9,19H,2,5-7,10-17H2/p+2 |
| InChIKey | DKHJWJYQHHRPQR-UHFFFAOYSA-P |
| XLogP | 0.74 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |