C20H34N2O+2 — CID 6945670
1-[(4-ethoxyphenyl)methyl]-4-[(3S)-3-methylpiperidin-1-ium-1-yl]piperidin-1-ium (PubChem CID 6945670) has the molecular formula C20H34N2O+2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-4-[(3S)-3-methylpiperidin-1-ium-1-yl]piperidin-1-ium.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3S)-3-methylpiperidin-1-ium-1-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 6945670 |
| Molecular Formula | C20H34N2O+2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3S)-3-methylpiperidin-1-ium-1-yl]piperidin-1-ium |
| SMILES | CCOc1ccc(C[NH+]2CCC([NH+]3CCC[C@H](C)C3)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O/c1-3-23-20-8-6-18(7-9-20)16-21-13-10-19(11-14-21)22-12-4-5-17(2)15-22/h6-9,17,19H,3-5,10-16H2,1-2H3/p+2/t17-/m0/s1 |
| InChIKey | YTKFWXBFVGRGTA-KRWDZBQOSA-P |
| XLogP | 0.95 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |