C20H34N2O+2 — CID 4745774
1-cycloheptyl-4-[(4-ethoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 4745774) has the molecular formula C20H34N2O+2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-cycloheptyl-4-[(4-ethoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-cycloheptyl-4-[(4-ethoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 4745774 |
| Molecular Formula | C20H34N2O+2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 1-cycloheptyl-4-[(4-ethoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | CCOc1ccc(C[NH+]2CC[NH+](C3CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O/c1-2-23-20-11-9-18(10-12-20)17-21-13-15-22(16-14-21)19-7-5-3-4-6-8-19/h9-12,19H,2-8,13-17H2,1H3/p+2 |
| InChIKey | FMLQOWWDZWZWGK-UHFFFAOYSA-P |
| XLogP | 1.09 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |