C21H25N2O2+ — CID 7380858
[(Z)-[(2R,5S)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]amino] benzoate (PubChem CID 7380858) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is [(Z)-[(2R,5S)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]amino] benzoate.
| Compound Name | [(Z)-[(2R,5S)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 7380858 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [(Z)-[(2R,5S)-1-benzyl-2,5-dimethylpiperidin-1-ium-4-ylidene]amino] benzoate |
| SMILES | C[C@@H]1C/C(=N/OC(=O)c2ccccc2)[C@@H](C)C[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-16-14-23(15-18-9-5-3-6-10-18)17(2)13-20(16)22-25-21(24)19-11-7-4-8-12-19/h3-12,16-17H,13-15H2,1-2H3/p+1/b22-20-/t16-,17+/m0/s1 |
| InChIKey | MGAKMROFEBFPEM-HCYZZJFPSA-O |
| XLogP | 2.71 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|