C20H16N2O4 — CID 54278652
[(4-benzylperoxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate (PubChem CID 54278652) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is [(4-benzylperoxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate.
| Compound Name | [(4-benzylperoxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
|---|---|
| PubChem CID | 54278652 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(4-benzylperoxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
| SMILES | O=C(ON=C1C=CC(=NOOCc2ccccc2)C=C1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4/c23-20(17-9-5-2-6-10-17)25-21-18-11-13-19(14-12-18)22-26-24-15-16-7-3-1-4-8-16/h1-14H,15H2/b21-18-,22-19+ |
| InChIKey | RPFKVERNZQQKFT-JXDXAWHESA-N |
| XLogP | 3.83 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|