C20H16N2O6S — CID 5229486
[[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methoxybenzoate (PubChem CID 5229486) has the molecular formula C20H16N2O6S and a molecular weight of 412.42 g/mol. Its IUPAC name is [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methoxybenzoate.
| Compound Name | [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methoxybenzoate |
|---|---|
| PubChem CID | 5229486 |
| Molecular Formula | C20H16N2O6S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C2C=CC(=NOS(=O)(=O)c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C20H16N2O6S/c1-26-18-13-7-15(8-14-18)20(23)27-21-16-9-11-17(12-10-16)22-28-29(24,25)19-5-3-2-4-6-19/h2-14H,1H3/b21-16-,22-17+ |
| InChIKey | SILQGCKJYYFLDE-ICZBVKINSA-N |
| XLogP | 3.10 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|