C19H16N2O6S2 — CID 5229184
[[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 5229184) has the molecular formula C19H16N2O6S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 5229184 |
| Molecular Formula | C19H16N2O6S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | [[4-(benzenesulfonyloxyimino)cyclohexa-2,5-dien-1-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON=C2C=CC(=NOS(=O)(=O)c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C19H16N2O6S2/c1-15-7-13-19(14-8-15)29(24,25)27-21-17-11-9-16(10-12-17)20-26-28(22,23)18-5-3-2-4-6-18/h2-14H,1H3/b20-16-,21-17+ |
| InChIKey | OKSILLWOSXLGSV-ARHRGINZSA-N |
| XLogP | 2.94 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|