About [(E)-benzylideneamino] 4-methylbenzenesulfonate
[(E)-benzylideneamino] 4-methylbenzenesulfonate (PubChem CID 20702846) has the molecular formula C14H13NO3S
and a molecular weight of 275.33 g/mol. Its IUPAC name is [(E)-benzylideneamino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(E)-benzylideneamino] 4-methylbenzenesulfonate |
| PubChem CID | 20702846 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [(E)-benzylideneamino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13NO3S/c1-12-7-9-14(10-8-12)19(16,17)18-15-11-13-5-3-2-4-6-13/h2-11H,1H3/b15-11+ |
| InChIKey | IRZDYZFJYUTZGH-RVDMUPIBSA-N |
| XLogP | 2.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-benzylideneamino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-benzylideneamino] 4-methylbenzenesulfonate?
The IUPAC name of [(E)-benzylideneamino] 4-methylbenzenesulfonate (CID 20702846) is [(E)-benzylideneamino] 4-methylbenzenesulfonate.
What is the SMILES notation for [(E)-benzylideneamino] 4-methylbenzenesulfonate?
The canonical SMILES for [(E)-benzylideneamino] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O/N=C/c2ccccc2)cc1.
What is the InChIKey of [(E)-benzylideneamino] 4-methylbenzenesulfonate?
The InChIKey is IRZDYZFJYUTZGH-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H13NO3S/c1-12-7-9-14(10-8-12)19(16,17)18-15-11-13-5-3-2-4-6-13/h2-11H,1H3/b15-11+.
What are the key properties of [(E)-benzylideneamino] 4-methylbenzenesulfonate?
[(E)-benzylideneamino] 4-methylbenzenesulfonate has a molecular weight of 275.33 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-benzylideneamino] 4-methylbenzenesulfonate is sourced from PubChem (CID 20702846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).