About formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate
formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate (PubChem CID 143113216) has the molecular formula C16H16O6S
and a molecular weight of 336.37 g/mol. Its IUPAC name is formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate.
Molecular Properties
| Compound Name | formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate |
| PubChem CID | 143113216 |
| Molecular Formula | C16H16O6S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate |
| SMILES | C=O.COC(=O)c1ccc(S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C15H14O5S.CH2O/c1-19-12-5-9-14(10-6-12)21(17,18)13-7-3-11(4-8-13)15(16)20-2;1-2/h3-10H,1-2H3;1H2 |
| InChIKey | CJXSYKFAPKAKJN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate?
The IUPAC name of formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate (CID 143113216) is formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate.
What is the SMILES notation for formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate?
The canonical SMILES for formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate is C=O.COC(=O)c1ccc(S(=O)(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate?
The InChIKey is CJXSYKFAPKAKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O5S.CH2O/c1-19-12-5-9-14(10-6-12)21(17,18)13-7-3-11(4-8-13)15(16)20-2;1-2/h3-10H,1-2H3;1H2.
What are the key properties of formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate?
formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate has a molecular weight of 336.37 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methyl 4-(4-methoxyphenyl)sulfonylbenzoate is sourced from PubChem (CID 143113216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).