C23H31N2O+ — CID 7104514
N-[(2S,3S,6S)-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7104514) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is N-[(2S,3S,6S)-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | N-[(2S,3S,6S)-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7104514 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-[(2S,3S,6S)-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | CCCCC[C@@H]1C(=NO)C[C@@H](c2ccccc2)[NH+](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-3-4-7-16-20-21(24-26)17-22(18-12-8-5-9-13-18)25(2)23(20)19-14-10-6-11-15-19/h5-6,8-15,20,22-23,26H,3-4,7,16-17H2,1-2H3/p+1/t20-,22+,23-/m1/s1 |
| InChIKey | BIMIEBMZQZLFKK-AKIFATBCSA-O |
| XLogP | 4.41 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|